C6H10CuN2O5 — CID 159494539
(2S)-2-(carbamoylamino)pentanedioic acid;copper (PubChem CID 159494539) has the molecular formula C6H10CuN2O5 and a molecular weight of 253.70 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)pentanedioic acid;copper.
| Compound Name | (2S)-2-(carbamoylamino)pentanedioic acid;copper |
|---|---|
| PubChem CID | 159494539 |
| Molecular Formula | C6H10CuN2O5 |
| Molecular Weight | 253.70 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | (2S)-2-(carbamoylamino)pentanedioic acid;copper |
| SMILES | NC(=O)N[C@@H](CCC(=O)O)C(=O)O.[Cu] |
| InChI | InChI=1S/C6H10N2O5.Cu/c7-6(13)8-3(5(11)12)1-2-4(9)10;/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13);/t3-;/m0./s1 |
| InChIKey | LYPSLPXPGMCAHP-DFWYDOINSA-N |
| XLogP | -1.03 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.70 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |