C15H21N2O8P — CID 143672053
(2S)-2-(carbamoylamino)pentanedioic acid;3-(4-hydroxy-3-phosphanylphenyl)propanoic acid (PubChem CID 143672053) has the molecular formula C15H21N2O8P and a molecular weight of 388.31 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)pentanedioic acid;3-(4-hydroxy-3-phosphanylphenyl)propanoic acid.
| Compound Name | (2S)-2-(carbamoylamino)pentanedioic acid;3-(4-hydroxy-3-phosphanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 143672053 |
| Molecular Formula | C15H21N2O8P |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (2S)-2-(carbamoylamino)pentanedioic acid;3-(4-hydroxy-3-phosphanylphenyl)propanoic acid |
| SMILES | NC(=O)N[C@@H](CCC(=O)O)C(=O)O.O=C(O)CCc1ccc(O)c(P)c1 |
| InChI | InChI=1S/C9H11O3P.C6H10N2O5/c10-7-3-1-6(5-8(7)13)2-4-9(11)12;7-6(13)8-3(5(11)12)1-2-4(9)10/h1,3,5,10H,2,4,13H2,(H,11,12);3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13)/t;3-/m.0/s1 |
| InChIKey | JTSIUSXKMQZLSF-HVDRVSQOSA-N |
| XLogP | -0.12 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|