C26H34N4O14 — CID 73356106
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(3,4-dihydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid (PubChem CID 73356106) has the molecular formula C26H34N4O14 and a molecular weight of 626.57 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(3,4-dihydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(3,4-dihydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 73356106 |
| Molecular Formula | C26H34N4O14 |
| Molecular Weight | 626.57 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(3,4-dihydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)c(O)c1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H34N4O14/c1-12(31)27-17(10-13-2-6-18(32)19(33)11-13)25(42)29-14(3-7-20(34)35)23(40)28-15(4-8-21(36)37)24(41)30-16(26(43)44)5-9-22(38)39/h2,6,11,14-17,32-33H,3-5,7-10H2,1H3,(H,27,31)(H,28,40)(H,29,42)(H,30,41)(H,34,35)(H,36,37)(H,38,39)(H,43,44)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | BNYYTPCHZVEEBD-QAETUUGQSA-N |
| XLogP | -1.72 |
| TPSA | 306.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.57 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|