C16H22N2O7 — CID 165116883
(2S)-2-[[(2S)-2-amino-3-(4-ethoxy-3-hydroxyphenyl)propanoyl]amino]pentanedioic acid (PubChem CID 165116883) has the molecular formula C16H22N2O7 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-(4-ethoxy-3-hydroxyphenyl)propanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-(4-ethoxy-3-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 165116883 |
| Molecular Formula | C16H22N2O7 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(4-ethoxy-3-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
| SMILES | CCOc1ccc(C[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1O |
| InChI | InChI=1S/C16H22N2O7/c1-2-25-13-5-3-9(8-12(13)19)7-10(17)15(22)18-11(16(23)24)4-6-14(20)21/h3,5,8,10-11,19H,2,4,6-7,17H2,1H3,(H,18,22)(H,20,21)(H,23,24)/t10-,11-/m0/s1 |
| InChIKey | MWENRFITGPIGEY-QWRGUYRKSA-N |
| XLogP | 0.09 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |