C24H35N5O9 — CID 19952385
5-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoic acid (PubChem CID 19952385) has the molecular formula C24H35N5O9 and a molecular weight of 537.57 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19952385 |
| Molecular Formula | C24H35N5O9 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylbutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H35N5O9/c1-12(2)20(23(36)28-17(24(37)38)7-9-18(26)31)29-22(35)16(8-10-19(32)33)27-21(34)15(25)11-13-3-5-14(30)6-4-13/h3-6,12,15-17,20,30H,7-11,25H2,1-2H3,(H2,26,31)(H,27,34)(H,28,36)(H,29,35)(H,32,33)(H,37,38) |
| InChIKey | YAPZGYOCQDEAQE-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |