C25H37N5O9 — CID 19952507
2-[[2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid (PubChem CID 19952507) has the molecular formula C25H37N5O9 and a molecular weight of 551.60 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 19952507 |
| Molecular Formula | C25H37N5O9 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C25H37N5O9/c1-3-13(2)21(25(38)39)30-24(37)18(9-11-20(33)34)29-23(36)17(8-10-19(27)32)28-22(35)16(26)12-14-4-6-15(31)7-5-14/h4-7,13,16-18,21,31H,3,8-12,26H2,1-2H3,(H2,27,32)(H,28,35)(H,29,36)(H,30,37)(H,33,34)(H,38,39) |
| InChIKey | WUVPEBIDUFDSAS-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |