C25H36N4O10 — CID 22699883
2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid (PubChem CID 22699883) has the molecular formula C25H36N4O10 and a molecular weight of 552.58 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 22699883 |
| Molecular Formula | C25H36N4O10 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H36N4O10/c1-3-13(2)21(25(38)39)29-23(36)17(9-11-20(33)34)27-24(37)18(12-14-4-6-15(30)7-5-14)28-22(35)16(26)8-10-19(31)32/h4-7,13,16-18,21,30H,3,8-12,26H2,1-2H3,(H,27,37)(H,28,35)(H,29,36)(H,31,32)(H,33,34)(H,38,39) |
| InChIKey | AVOVPBPAUFWZOF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 245.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |