C15H20N2O9 — CID 145267669
(2S)-2-acetamidobutanedioic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 145267669) has the molecular formula C15H20N2O9 and a molecular weight of 372.33 g/mol. Its IUPAC name is (2S)-2-acetamidobutanedioic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-acetamidobutanedioic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 145267669 |
| Molecular Formula | C15H20N2O9 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (2S)-2-acetamidobutanedioic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)O.N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO4.C6H9NO5/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;1-3(8)7-4(6(11)12)2-5(9)10/h1-2,4,6,11-12H,3,10H2,(H,13,14);4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/t6-;4-/m00/s1 |
| InChIKey | GILBTZPEHPVUKE-FPAZSGHZSA-N |
| XLogP | -0.90 |
| TPSA | 207.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|