C16H22N2O7 — CID 144798696
(2S)-2-acetamido-4-oxopentanoic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanal (PubChem CID 144798696) has the molecular formula C16H22N2O7 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2S)-2-acetamido-4-oxopentanoic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanal.
| Compound Name | (2S)-2-acetamido-4-oxopentanoic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanal |
|---|---|
| PubChem CID | 144798696 |
| Molecular Formula | C16H22N2O7 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (2S)-2-acetamido-4-oxopentanoic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanal |
| SMILES | CC(=O)C[C@H](NC(C)=O)C(=O)O.N[C@H](C=O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO3.C7H11NO4/c10-7(5-11)3-6-1-2-8(12)9(13)4-6;1-4(9)3-6(7(11)12)8-5(2)10/h1-2,4-5,7,12-13H,3,10H2;6H,3H2,1-2H3,(H,8,10)(H,11,12)/t7-;6-/m00/s1 |
| InChIKey | AHMPKCQPNGYSJK-KSTOEEEWSA-N |
| XLogP | -0.28 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|