C6H12N4O4 — CID 139469955
4-(carbamoylamino)-5-hydrazinyl-5-oxopentanoic acid (PubChem CID 139469955) has the molecular formula C6H12N4O4 and a molecular weight of 204.19 g/mol. Its IUPAC name is 4-(carbamoylamino)-5-hydrazinyl-5-oxopentanoic acid.
| Compound Name | 4-(carbamoylamino)-5-hydrazinyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139469955 |
| Molecular Formula | C6H12N4O4 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-(carbamoylamino)-5-hydrazinyl-5-oxopentanoic acid |
| SMILES | NNC(=O)C(CCC(=O)O)NC(N)=O |
| InChI | InChI=1S/C6H12N4O4/c7-6(14)9-3(5(13)10-8)1-2-4(11)12/h3H,1-2,8H2,(H,10,13)(H,11,12)(H3,7,9,14) |
| InChIKey | MPADCIRSZJIZDN-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|