C7H12N2O4 — CID 137467884
(4R)-5-(carbamoylamino)-4-methyl-5-oxopentanoic acid (PubChem CID 137467884) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is (4R)-5-(carbamoylamino)-4-methyl-5-oxopentanoic acid.
| Compound Name | (4R)-5-(carbamoylamino)-4-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 137467884 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (4R)-5-(carbamoylamino)-4-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CCC(=O)O)C(=O)NC(N)=O |
| InChI | InChI=1S/C7H12N2O4/c1-4(2-3-5(10)11)6(12)9-7(8)13/h4H,2-3H2,1H3,(H,10,11)(H3,8,9,12,13)/t4-/m1/s1 |
| InChIKey | VMQAHANHSKLUFJ-SCSAIBSYSA-N |
| XLogP | -0.32 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |