C8H12Cl3N2NaO4 — CID 100967419
sodium (2S)-5-amino-2-(2,2,2-trichloroethoxycarbonylamino)pentanoate (PubChem CID 100967419) has the molecular formula C8H12Cl3N2NaO4 and a molecular weight of 329.54 g/mol. Its IUPAC name is sodium (2S)-5-amino-2-(2,2,2-trichloroethoxycarbonylamino)pentanoate.
| Compound Name | sodium (2S)-5-amino-2-(2,2,2-trichloroethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 100967419 |
| Molecular Formula | C8H12Cl3N2NaO4 |
| Molecular Weight | 329.54 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | sodium (2S)-5-amino-2-(2,2,2-trichloroethoxycarbonylamino)pentanoate |
| SMILES | NCCC[C@H](NC(=O)OCC(Cl)(Cl)Cl)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H13Cl3N2O4.Na/c9-8(10,11)4-17-7(16)13-5(6(14)15)2-1-3-12;/h5H,1-4,12H2,(H,13,16)(H,14,15);/q;+1/p-1/t5-;/m0./s1 |
| InChIKey | PABJUNHMQLJWLQ-JEDNCBNOSA-M |
| XLogP | -3.06 |
| TPSA | 104.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.54 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|