C13H22Cl3NO5S — CID 10454255
tert-butyl (2R)-3-(3-hydroxypropylsulfanyl)-2-(2,2,2-trichloroethoxycarbonylamino)propanoate (PubChem CID 10454255) has the molecular formula C13H22Cl3NO5S and a molecular weight of 410.75 g/mol. Its IUPAC name is tert-butyl (2R)-3-(3-hydroxypropylsulfanyl)-2-(2,2,2-trichloroethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl (2R)-3-(3-hydroxypropylsulfanyl)-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10454255 |
| Molecular Formula | C13H22Cl3NO5S |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | tert-butyl (2R)-3-(3-hydroxypropylsulfanyl)-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CSCCCO)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H22Cl3NO5S/c1-12(2,3)22-10(19)9(7-23-6-4-5-18)17-11(20)21-8-13(14,15)16/h9,18H,4-8H2,1-3H3,(H,17,20)/t9-/m0/s1 |
| InChIKey | CRCWZZFTMZPVGO-VIFPVBQESA-N |
| XLogP | 2.91 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|