C22H35Cl3N2O8 — CID 159446148
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid;2,2,2-trichloroethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 159446148) has the molecular formula C22H35Cl3N2O8 and a molecular weight of 561.89 g/mol. Its IUPAC name is (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid;2,2,2-trichloroethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid;2,2,2-trichloroethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 159446148 |
| Molecular Formula | C22H35Cl3N2O8 |
| Molecular Weight | 561.89 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid;2,2,2-trichloroethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=CC[C@@H](NC(=O)OC(C)(C)C)C(=O)O.C=CC[C@@H](NC(=O)OC(C)(C)C)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl3NO4.C10H17NO4/c1-5-6-8(9(17)19-7-12(13,14)15)16-10(18)20-11(2,3)4;1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,16,18);5,7H,1,6H2,2-4H3,(H,11,14)(H,12,13)/t8-;7-/m11/s1 |
| InChIKey | LSUCLTOFMZEWIO-CPVNYBHJSA-N |
| XLogP | 4.91 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|