C11H19NO4 — CID 54147338
tert-butyl N-(1-hydroxy-2-oxohex-5-en-3-yl)carbamate (PubChem CID 54147338) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-2-oxohex-5-en-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-hydroxy-2-oxohex-5-en-3-yl)carbamate |
|---|---|
| PubChem CID | 54147338 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | tert-butyl N-(1-hydroxy-2-oxohex-5-en-3-yl)carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)C(=O)CO |
| InChI | InChI=1S/C11H19NO4/c1-5-6-8(9(14)7-13)12-10(15)16-11(2,3)4/h5,8,13H,1,6-7H2,2-4H3,(H,12,15) |
| InChIKey | OFHXLWDKICCTCA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|