C13H24N2O3 — CID 163901236
tert-butyl N-[1-oxo-1-(propylamino)pent-4-en-2-yl]carbamate (PubChem CID 163901236) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-(propylamino)pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-(propylamino)pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 163901236 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | tert-butyl N-[1-oxo-1-(propylamino)pent-4-en-2-yl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)C(=O)NCCC |
| InChI | InChI=1S/C13H24N2O3/c1-6-8-10(11(16)14-9-7-2)15-12(17)18-13(3,4)5/h6,10H,1,7-9H2,2-5H3,(H,14,16)(H,15,17) |
| InChIKey | QKBFJXGIZQQKQH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|