C14H25NO4S — CID 102416479
ethyl (2R)-3-but-3-enylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 102416479) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is ethyl (2R)-3-but-3-enylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl (2R)-3-but-3-enylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 102416479 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl (2R)-3-but-3-enylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C=CCCSC[C@H](NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C14H25NO4S/c1-6-8-9-20-10-11(12(16)18-7-2)15-13(17)19-14(3,4)5/h6,11H,1,7-10H2,2-5H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | PDAACLOXFTUZDL-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|