C14H27NO4S2 — CID 135013366
ethyl 3-(tert-butyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 135013366) has the molecular formula C14H27NO4S2 and a molecular weight of 337.51 g/mol. Its IUPAC name is ethyl 3-(tert-butyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl 3-(tert-butyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 135013366 |
| Molecular Formula | C14H27NO4S2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | ethyl 3-(tert-butyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C(CSSC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27NO4S2/c1-8-18-11(16)10(9-20-21-14(5,6)7)15-12(17)19-13(2,3)4/h10H,8-9H2,1-7H3,(H,15,17) |
| InChIKey | YBAASAWYGMHJIO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|