C14H27NO4 — CID 170262393
ethyl 5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 170262393) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | ethyl 5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 170262393 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | ethyl 5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CCOC(=O)C(CCC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27NO4/c1-7-18-12(16)11(9-8-10(2)3)15-13(17)19-14(4,5)6/h10-11H,7-9H2,1-6H3,(H,15,17) |
| InChIKey | CYPPTRGVYQNQOO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |