C13H23NO5S — CID 90160706
prop-2-enyl (2R)-3-(2-hydroxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 90160706) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is prop-2-enyl (2R)-3-(2-hydroxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | prop-2-enyl (2R)-3-(2-hydroxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 90160706 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | prop-2-enyl (2R)-3-(2-hydroxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C=CCOC(=O)[C@H](CSCCO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO5S/c1-5-7-18-11(16)10(9-20-8-6-15)14-12(17)19-13(2,3)4/h5,10,15H,1,6-9H2,2-4H3,(H,14,17)/t10-/m0/s1 |
| InChIKey | CFHBBOYRZREQTO-JTQLQIEISA-N |
| XLogP | 1.33 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|