C12H21NO5 — CID 10539205
2-hydroxyethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 10539205) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-hydroxyethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | 2-hydroxyethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 10539205 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-hydroxyethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=CC[C@@H](NC(=O)OC(C)(C)C)C(=O)OCCO |
| InChI | InChI=1S/C12H21NO5/c1-5-6-9(10(15)17-8-7-14)13-11(16)18-12(2,3)4/h5,9,14H,1,6-8H2,2-4H3,(H,13,16)/t9-/m1/s1 |
| InChIKey | XCXJMRUMDQPBRL-SECBINFHSA-N |
| XLogP | 0.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|