C11H18INO4 — CID 11245189
prop-2-enyl (2S)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 11245189) has the molecular formula C11H18INO4 and a molecular weight of 355.17 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | prop-2-enyl (2S)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 11245189 |
| Molecular Formula | C11H18INO4 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | prop-2-enyl (2S)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C=CCOC(=O)[C@@H](CI)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18INO4/c1-5-6-16-9(14)8(7-12)13-10(15)17-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | XRMJHJGYWAAVPS-MRVPVSSYSA-N |
| XLogP | 2.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|