C23H38N2O7 — CID 134322919
prop-2-enyl 4-methyl-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]pent-3-enoate (PubChem CID 134322919) has the molecular formula C23H38N2O7 and a molecular weight of 454.56 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]pent-3-enoate.
| Compound Name | prop-2-enyl 4-methyl-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]pent-3-enoate |
|---|---|
| PubChem CID | 134322919 |
| Molecular Formula | C23H38N2O7 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | prop-2-enyl 4-methyl-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]pent-3-enoate |
| SMILES | C=CCOC(=O)C(C=C(C)C)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38N2O7/c1-10-13-30-20(28)17(14-15(2)3)24-19(27)16(25-21(29)32-23(7,8)9)11-12-18(26)31-22(4,5)6/h10,14,16-17H,1,11-13H2,2-9H3,(H,24,27)(H,25,29)/t16-,17?/m0/s1 |
| InChIKey | DJKGDOOSNMLCMK-BHWOMJMDSA-N |
| XLogP | 3.18 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|