C12H20INO4 — CID 146526976
iodomethyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-3-enoate (PubChem CID 146526976) has the molecular formula C12H20INO4 and a molecular weight of 369.20 g/mol. Its IUPAC name is iodomethyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-3-enoate.
| Compound Name | iodomethyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-3-enoate |
|---|---|
| PubChem CID | 146526976 |
| Molecular Formula | C12H20INO4 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | iodomethyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-3-enoate |
| SMILES | CC(C)=C[C@H](NC(=O)OC(C)(C)C)C(=O)OCI |
| InChI | InChI=1S/C12H20INO4/c1-8(2)6-9(10(15)17-7-13)14-11(16)18-12(3,4)5/h6,9H,7H2,1-5H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | MLYJKQRTCMADLR-VIFPVBQESA-N |
| XLogP | 2.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|