C10H16N2O5 — CID 144508954
(E,2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopent-3-enoic acid (PubChem CID 144508954) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is (E,2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopent-3-enoic acid.
| Compound Name | (E,2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopent-3-enoic acid |
|---|---|
| PubChem CID | 144508954 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (E,2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopent-3-enoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](/C=C/C(N)=O)C(=O)O |
| InChI | InChI=1S/C10H16N2O5/c1-10(2,3)17-9(16)12-6(8(14)15)4-5-7(11)13/h4-6H,1-3H3,(H2,11,13)(H,12,16)(H,14,15)/b5-4+/t6-/m0/s1 |
| InChIKey | OROOXPOSTNITBY-OVCGOVNKSA-N |
| XLogP | 0.01 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|