C17H25NO4Si — CID 139263768
(E,2R)-4-[dimethyl(phenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid (PubChem CID 139263768) has the molecular formula C17H25NO4Si and a molecular weight of 335.48 g/mol. Its IUPAC name is (E,2R)-4-[dimethyl(phenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid.
| Compound Name | (E,2R)-4-[dimethyl(phenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid |
|---|---|
| PubChem CID | 139263768 |
| Molecular Formula | C17H25NO4Si |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (E,2R)-4-[dimethyl(phenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/[Si](C)(C)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25NO4Si/c1-17(2,3)22-16(21)18-14(15(19)20)11-12-23(4,5)13-9-7-6-8-10-13/h6-12,14H,1-5H3,(H,18,21)(H,19,20)/b12-11+/t14-/m1/s1 |
| InChIKey | VEYWARPMTVOCCL-GCZGRYASSA-N |
| XLogP | 2.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|