C23H33NO2Si — CID 12045291
tert-butyl N-[1-[methyl(diphenyl)silyl]pentyl]carbamate (PubChem CID 12045291) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is tert-butyl N-[1-[methyl(diphenyl)silyl]pentyl]carbamate.
| Compound Name | tert-butyl N-[1-[methyl(diphenyl)silyl]pentyl]carbamate |
|---|---|
| PubChem CID | 12045291 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl N-[1-[methyl(diphenyl)silyl]pentyl]carbamate |
| SMILES | CCCCC(NC(=O)OC(C)(C)C)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H33NO2Si/c1-6-7-18-21(24-22(25)26-23(2,3)4)27(5,19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-17,21H,6-7,18H2,1-5H3,(H,24,25) |
| InChIKey | NBBFXDHKIGYCDZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|