C19H31NO3 — CID 101411554
tert-butyl N-(1-hydroxy-1-phenyloctan-3-yl)carbamate (PubChem CID 101411554) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-1-phenyloctan-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-hydroxy-1-phenyloctan-3-yl)carbamate |
|---|---|
| PubChem CID | 101411554 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | tert-butyl N-(1-hydroxy-1-phenyloctan-3-yl)carbamate |
| SMILES | CCCCCC(CC(O)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31NO3/c1-5-6-8-13-16(20-18(22)23-19(2,3)4)14-17(21)15-11-9-7-10-12-15/h7,9-12,16-17,21H,5-6,8,13-14H2,1-4H3,(H,20,22) |
| InChIKey | XMPZUENBBCBRJK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|