C19H29NO3 — CID 10286488
tert-butyl N-(2-methyl-3-oxo-1-phenylheptyl)carbamate (PubChem CID 10286488) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-3-oxo-1-phenylheptyl)carbamate.
| Compound Name | tert-butyl N-(2-methyl-3-oxo-1-phenylheptyl)carbamate |
|---|---|
| PubChem CID | 10286488 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | tert-butyl N-(2-methyl-3-oxo-1-phenylheptyl)carbamate |
| SMILES | CCCCC(=O)C(C)C(NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H29NO3/c1-6-7-13-16(21)14(2)17(15-11-9-8-10-12-15)20-18(22)23-19(3,4)5/h8-12,14,17H,6-7,13H2,1-5H3,(H,20,22) |
| InChIKey | CCCFYKSXGAAYPF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |