C24H25N3O2 — CID 135004110
tert-butyl N-(4,4-dicyano-2-methyl-1,3-diphenylbut-3-enyl)carbamate (PubChem CID 135004110) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl N-(4,4-dicyano-2-methyl-1,3-diphenylbut-3-enyl)carbamate.
| Compound Name | tert-butyl N-(4,4-dicyano-2-methyl-1,3-diphenylbut-3-enyl)carbamate |
|---|---|
| PubChem CID | 135004110 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | tert-butyl N-(4,4-dicyano-2-methyl-1,3-diphenylbut-3-enyl)carbamate |
| SMILES | CC(C(=C(C#N)C#N)c1ccccc1)C(NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O2/c1-17(21(20(15-25)16-26)18-11-7-5-8-12-18)22(19-13-9-6-10-14-19)27-23(28)29-24(2,3)4/h5-14,17,22H,1-4H3,(H,27,28) |
| InChIKey | UPCPNNINDKZYHV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|