C19H29NO3 — CID 15858562
tert-butyl N-[(2S)-3-oxo-1-phenyloctan-2-yl]carbamate (PubChem CID 15858562) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-oxo-1-phenyloctan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-oxo-1-phenyloctan-2-yl]carbamate |
|---|---|
| PubChem CID | 15858562 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | tert-butyl N-[(2S)-3-oxo-1-phenyloctan-2-yl]carbamate |
| SMILES | CCCCCC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29NO3/c1-5-6-8-13-17(21)16(14-15-11-9-7-10-12-15)20-18(22)23-19(2,3)4/h7,9-12,16H,5-6,8,13-14H2,1-4H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | WQFQSRFFKFREMU-INIZCTEOSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|