C17H24BrNO3 — CID 66863791
tert-butyl N-[1-(4-bromophenyl)-3-oxohexan-2-yl]carbamate (PubChem CID 66863791) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is tert-butyl N-[1-(4-bromophenyl)-3-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-bromophenyl)-3-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 66863791 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | tert-butyl N-[1-(4-bromophenyl)-3-oxohexan-2-yl]carbamate |
| SMILES | CCCC(=O)C(Cc1ccc(Br)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24BrNO3/c1-5-6-15(20)14(19-16(21)22-17(2,3)4)11-12-7-9-13(18)10-8-12/h7-10,14H,5-6,11H2,1-4H3,(H,19,21) |
| InChIKey | JVCWPOKTFIKXDY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |