C22H24BrNO6 — CID 173429430
[(3S)-1-(4-bromophenyl)-4-(4-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl] formate (PubChem CID 173429430) has the molecular formula C22H24BrNO6 and a molecular weight of 478.34 g/mol. Its IUPAC name is [(3S)-1-(4-bromophenyl)-4-(4-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl] formate.
| Compound Name | [(3S)-1-(4-bromophenyl)-4-(4-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl] formate |
|---|---|
| PubChem CID | 173429430 |
| Molecular Formula | C22H24BrNO6 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | [(3S)-1-(4-bromophenyl)-4-(4-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl] formate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)C(OC=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H24BrNO6/c1-22(2,3)30-21(28)24-18(12-14-4-10-17(26)11-5-14)19(27)20(29-13-25)15-6-8-16(23)9-7-15/h4-11,13,18,20,26H,12H2,1-3H3,(H,24,28)/t18-,20?/m0/s1 |
| InChIKey | BNWBOEBHGABODI-LROBGIAVSA-N |
| XLogP | 4.07 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|