C16H23NO5S — CID 10871564
methylsulfanylmethyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 10871564) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is methylsulfanylmethyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methylsulfanylmethyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 10871564 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methylsulfanylmethyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CSCOC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO5S/c1-16(2,3)22-15(20)17-13(14(19)21-10-23-4)9-11-5-7-12(18)8-6-11/h5-8,13,18H,9-10H2,1-4H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | TUMJZCMNUAKQRD-ZDUSSCGKSA-N |
| XLogP | 2.69 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|