C19H30N4O5S — CID 7224759
tert-butyl N-[(2S)-1-[[(2R)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 7224759) has the molecular formula C19H30N4O5S and a molecular weight of 426.54 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2R)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2R)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 7224759 |
| Molecular Formula | C19H30N4O5S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2R)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)NN |
| InChI | InChI=1S/C19H30N4O5S/c1-19(2,3)28-18(27)22-14(9-10-29-4)16(25)21-15(17(26)23-20)11-12-5-7-13(24)8-6-12/h5-8,14-15,24H,9-11,20H2,1-4H3,(H,21,25)(H,22,27)(H,23,26)/t14-,15+/m0/s1 |
| InChIKey | ZWHHOPLBYKPIHB-LSDHHAIUSA-N |
| XLogP | 1.06 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|