C27H30Cl5N3O7S — CID 57001407
(2,3,4,5,6-pentachlorophenyl) 2-[[(2R)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetate (PubChem CID 57001407) has the molecular formula C27H30Cl5N3O7S and a molecular weight of 717.88 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) 2-[[(2R)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) 2-[[(2R)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetate |
|---|---|
| PubChem CID | 57001407 |
| Molecular Formula | C27H30Cl5N3O7S |
| Molecular Weight | 717.88 g/mol |
| Exact Mass | 715.02 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) 2-[[(2R)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetate |
| SMILES | CSCC[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(=O)NCC(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C27H30Cl5N3O7S/c1-27(2,3)42-26(40)35-16(11-13-5-7-14(36)8-6-13)25(39)34-15(9-10-43-4)24(38)33-12-17(37)41-23-21(31)19(29)18(28)20(30)22(23)32/h5-8,15-16,36H,9-12H2,1-4H3,(H,33,38)(H,34,39)(H,35,40)/t15-,16+/m1/s1 |
| InChIKey | GGWZAELIEAHYBF-CVEARBPZSA-N |
| XLogP | 6.05 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.88 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|