C25H26Cl5N3O6 — CID 96582473
(2,3,4,5,6-pentachlorophenyl) 2-[[(2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoyl]amino]acetate (PubChem CID 96582473) has the molecular formula C25H26Cl5N3O6 and a molecular weight of 641.76 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) 2-[[(2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoyl]amino]acetate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) 2-[[(2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 96582473 |
| Molecular Formula | C25H26Cl5N3O6 |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 639.03 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) 2-[[(2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoyl]amino]acetate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C25H26Cl5N3O6/c1-12(32-24(37)39-25(2,3)4)22(35)33-14(10-13-8-6-5-7-9-13)23(36)31-11-15(34)38-21-19(29)17(27)16(26)18(28)20(21)30/h5-9,12,14H,10-11H2,1-4H3,(H,31,36)(H,32,37)(H,33,35)/t12-,14+/m0/s1 |
| InChIKey | GOZCYBJCSFBIQE-GXTWGEPZSA-N |
| XLogP | 5.62 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|