C23H28N2O5 — CID 71159599
tert-butyl N-[(2S,5S)-5-amino-6-(4-hydroxyphenyl)-3,4-dioxo-1-phenylhexan-2-yl]carbamate (PubChem CID 71159599) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl N-[(2S,5S)-5-amino-6-(4-hydroxyphenyl)-3,4-dioxo-1-phenylhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,5S)-5-amino-6-(4-hydroxyphenyl)-3,4-dioxo-1-phenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 71159599 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | tert-butyl N-[(2S,5S)-5-amino-6-(4-hydroxyphenyl)-3,4-dioxo-1-phenylhexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)C(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-23(2,3)30-22(29)25-19(14-15-7-5-4-6-8-15)21(28)20(27)18(24)13-16-9-11-17(26)12-10-16/h4-12,18-19,26H,13-14,24H2,1-3H3,(H,25,29)/t18-,19-/m0/s1 |
| InChIKey | OAWHAGJFECFWMU-OALUTQOASA-N |
| XLogP | 2.54 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|