C16H22BrN3O5 — CID 135239010
2-[(Z)-[1-amino-3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]amino]oxyacetic acid (PubChem CID 135239010) has the molecular formula C16H22BrN3O5 and a molecular weight of 416.27 g/mol. Its IUPAC name is 2-[(Z)-[1-amino-3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]amino]oxyacetic acid.
| Compound Name | 2-[(Z)-[1-amino-3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 135239010 |
| Molecular Formula | C16H22BrN3O5 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-[(Z)-[1-amino-3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]amino]oxyacetic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(Br)cc1)/C(N)=N/OCC(=O)O |
| InChI | InChI=1S/C16H22BrN3O5/c1-16(2,3)25-15(23)19-12(14(18)20-24-9-13(21)22)8-10-4-6-11(17)7-5-10/h4-7,12H,8-9H2,1-3H3,(H2,18,20)(H,19,23)(H,21,22) |
| InChIKey | XHLCKHCGEVJLFR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|