C32H55NO4 — CID 168741355
2-octyldecyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 168741355) has the molecular formula C32H55NO4 and a molecular weight of 517.80 g/mol. Its IUPAC name is 2-octyldecyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate.
| Compound Name | 2-octyldecyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 168741355 |
| Molecular Formula | C32H55NO4 |
| Molecular Weight | 517.80 g/mol |
| Exact Mass | 517.41 |
| IUPAC Name | 2-octyldecyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)COC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H55NO4/c1-6-8-10-12-14-17-23-28(24-18-15-13-11-9-7-2)26-36-30(34)29(25-27-21-19-16-20-22-27)33-31(35)37-32(3,4)5/h16,19-22,28-29H,6-15,17-18,23-26H2,1-5H3,(H,33,35)/t29-/m0/s1 |
| InChIKey | MEPWJKQLVVGIHL-LJAQVGFWSA-N |
| XLogP | 8.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.80 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|