C28H45F2NO4 — CID 168741660
2-hexyloctyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 168741660) has the molecular formula C28H45F2NO4 and a molecular weight of 497.67 g/mol. Its IUPAC name is 2-hexyloctyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 2-hexyloctyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 168741660 |
| Molecular Formula | C28H45F2NO4 |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 2-hexyloctyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCCCCCC(CCCCCC)COC(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H45F2NO4/c1-6-8-10-12-14-21(15-13-11-9-7-2)20-34-26(32)25(31-27(33)35-28(3,4)5)18-22-16-23(29)19-24(30)17-22/h16-17,19,21,25H,6-15,18,20H2,1-5H3,(H,31,33)/t25-/m0/s1 |
| InChIKey | DTUZEBFNNCQFKQ-VWLOTQADSA-N |
| XLogP | 7.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|