C25H37NO3Si — CID 46221435
tert-butyl N-[(1R)-1-[3-hydroxypropyl(diphenyl)silyl]-3-methylbutyl]carbamate (PubChem CID 46221435) has the molecular formula C25H37NO3Si and a molecular weight of 427.66 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[3-hydroxypropyl(diphenyl)silyl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[3-hydroxypropyl(diphenyl)silyl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 46221435 |
| Molecular Formula | C25H37NO3Si |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | tert-butyl N-[(1R)-1-[3-hydroxypropyl(diphenyl)silyl]-3-methylbutyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[Si](CCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H37NO3Si/c1-20(2)19-23(26-24(28)29-25(3,4)5)30(18-12-17-27,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-11,13-16,20,23,27H,12,17-19H2,1-5H3,(H,26,28)/t23-/m1/s1 |
| InChIKey | XPNDAGYIJAJVGJ-HSZRJFAPSA-N |
| XLogP | 4.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|