C20H27NO3 — CID 175560778
1,1'-biphenyl;tert-butyl N-[(2R)-1-hydroxypropan-2-yl]carbamate (PubChem CID 175560778) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1,1'-biphenyl;tert-butyl N-[(2R)-1-hydroxypropan-2-yl]carbamate.
| Compound Name | 1,1'-biphenyl;tert-butyl N-[(2R)-1-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175560778 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1,1'-biphenyl;tert-butyl N-[(2R)-1-hydroxypropan-2-yl]carbamate |
| SMILES | C[C@H](CO)NC(=O)OC(C)(C)C.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H17NO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-6(5-10)9-7(11)12-8(2,3)4/h1-10H;6,10H,5H2,1-4H3,(H,9,11)/t;6-/m.1/s1 |
| InChIKey | MGXZQVLBMWYWLJ-FCXZQVPUSA-N |
| XLogP | 4.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |