C21H29NO3Si — CID 46221200
tert-butyl N-[(1R)-3-hydroxy-1-[methyl(diphenyl)silyl]propyl]carbamate (PubChem CID 46221200) has the molecular formula C21H29NO3Si and a molecular weight of 371.55 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3-hydroxy-1-[methyl(diphenyl)silyl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3-hydroxy-1-[methyl(diphenyl)silyl]propyl]carbamate |
|---|---|
| PubChem CID | 46221200 |
| Molecular Formula | C21H29NO3Si |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | tert-butyl N-[(1R)-3-hydroxy-1-[methyl(diphenyl)silyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCO)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO3Si/c1-21(2,3)25-20(24)22-19(15-16-23)26(4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19,23H,15-16H2,1-4H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | PAZZOSYTLZJDTR-LJQANCHMSA-N |
| XLogP | 2.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|