C20H29NO2SSi — CID 46220978
(R)-N-[(1R)-3-hydroxy-1-[methyl(diphenyl)silyl]propyl]-2-methylpropane-2-sulfinamide (PubChem CID 46220978) has the molecular formula C20H29NO2SSi and a molecular weight of 375.61 g/mol. Its IUPAC name is (R)-N-[(1R)-3-hydroxy-1-[methyl(diphenyl)silyl]propyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-3-hydroxy-1-[methyl(diphenyl)silyl]propyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 46220978 |
| Molecular Formula | C20H29NO2SSi |
| Molecular Weight | 375.61 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (R)-N-[(1R)-3-hydroxy-1-[methyl(diphenyl)silyl]propyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H](CCO)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H29NO2SSi/c1-20(2,3)24(23)21-19(15-16-22)25(4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19,21-22H,15-16H2,1-4H3/t19-,24-/m1/s1 |
| InChIKey | DADQOGTUCBSAHD-NTKDMRAZSA-N |
| XLogP | 2.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|