C28H43NO3SSi — CID 25112546
(R)-2-methyl-N-[(1R)-1-[3-(oxan-2-yloxy)propyl-diphenylsilyl]butyl]propane-2-sulfinamide (PubChem CID 25112546) has the molecular formula C28H43NO3SSi and a molecular weight of 501.81 g/mol. Its IUPAC name is (R)-2-methyl-N-[(1R)-1-[3-(oxan-2-yloxy)propyl-diphenylsilyl]butyl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(1R)-1-[3-(oxan-2-yloxy)propyl-diphenylsilyl]butyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 25112546 |
| Molecular Formula | C28H43NO3SSi |
| Molecular Weight | 501.81 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (R)-2-methyl-N-[(1R)-1-[3-(oxan-2-yloxy)propyl-diphenylsilyl]butyl]propane-2-sulfinamide |
| SMILES | CCC[C@H](N[S@](=O)C(C)(C)C)[Si](CCCOC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H43NO3SSi/c1-5-15-26(29-33(30)28(2,3)4)34(24-16-8-6-9-17-24,25-18-10-7-11-19-25)23-14-22-32-27-20-12-13-21-31-27/h6-11,16-19,26-27,29H,5,12-15,20-23H2,1-4H3/t26-,27?,33-/m1/s1 |
| InChIKey | ZHORPWKUMXADPJ-XQKSBISZSA-N |
| XLogP | 4.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|