C32H50O3Si2 — CID 10602504
tert-butyl-[(Z)-1-(oxan-2-yloxy)-8-trimethylsilyloct-5-en-4-yl]oxy-diphenylsilane (PubChem CID 10602504) has the molecular formula C32H50O3Si2 and a molecular weight of 538.92 g/mol. Its IUPAC name is tert-butyl-[(Z)-1-(oxan-2-yloxy)-8-trimethylsilyloct-5-en-4-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(Z)-1-(oxan-2-yloxy)-8-trimethylsilyloct-5-en-4-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10602504 |
| Molecular Formula | C32H50O3Si2 |
| Molecular Weight | 538.92 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | tert-butyl-[(Z)-1-(oxan-2-yloxy)-8-trimethylsilyloct-5-en-4-yl]oxy-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC(/C=C\CC[Si](C)(C)C)CCCOC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H50O3Si2/c1-32(2,3)37(29-20-9-7-10-21-29,30-22-11-8-12-23-30)35-28(18-14-16-27-36(4,5)6)19-17-26-34-31-24-13-15-25-33-31/h7-12,14,18,20-23,28,31H,13,15-17,19,24-27H2,1-6H3/b18-14- |
| InChIKey | PSGIXQTWSGTOCL-JXAWBTAJSA-N |
| XLogP | 7.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.92 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|