C32H54O6Si — CID 135026628
tert-butyl-[(1R,2R,3E,5E,7R)-7-methoxy-2-(methoxymethoxy)-6-methyl-11-(oxan-2-yloxy)-1-phenylundeca-3,5-dienoxy]-dimethylsilane (PubChem CID 135026628) has the molecular formula C32H54O6Si and a molecular weight of 562.86 g/mol. Its IUPAC name is tert-butyl-[(1R,2R,3E,5E,7R)-7-methoxy-2-(methoxymethoxy)-6-methyl-11-(oxan-2-yloxy)-1-phenylundeca-3,5-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R,3E,5E,7R)-7-methoxy-2-(methoxymethoxy)-6-methyl-11-(oxan-2-yloxy)-1-phenylundeca-3,5-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135026628 |
| Molecular Formula | C32H54O6Si |
| Molecular Weight | 562.86 g/mol |
| Exact Mass | 562.37 |
| IUPAC Name | tert-butyl-[(1R,2R,3E,5E,7R)-7-methoxy-2-(methoxymethoxy)-6-methyl-11-(oxan-2-yloxy)-1-phenylundeca-3,5-dienoxy]-dimethylsilane |
| SMILES | COCO[C@H](/C=C/C=C(\C)[C@@H](CCCCOC1CCCCO1)OC)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H54O6Si/c1-26(28(34-6)20-12-14-23-35-30-22-13-15-24-36-30)17-16-21-29(37-25-33-5)31(27-18-10-9-11-19-27)38-39(7,8)32(2,3)4/h9-11,16-19,21,28-31H,12-15,20,22-25H2,1-8H3/b21-16+,26-17+/t28-,29-,30?,31-/m1/s1 |
| InChIKey | VOTQTLDKGUWZJN-QDJJATSNSA-N |
| XLogP | 7.97 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.86 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|