C22H36O3Si — CID 101421937
tert-butyl-dimethyl-[(E,3R)-5-(oxan-2-yloxy)-1-phenylpent-1-en-3-yl]oxysilane (PubChem CID 101421937) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,3R)-5-(oxan-2-yloxy)-1-phenylpent-1-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,3R)-5-(oxan-2-yloxy)-1-phenylpent-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 101421937 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | tert-butyl-dimethyl-[(E,3R)-5-(oxan-2-yloxy)-1-phenylpent-1-en-3-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/c1ccccc1)CCOC1CCCCO1 |
| InChI | InChI=1S/C22H36O3Si/c1-22(2,3)26(4,5)25-20(15-14-19-11-7-6-8-12-19)16-18-24-21-13-9-10-17-23-21/h6-8,11-12,14-15,20-21H,9-10,13,16-18H2,1-5H3/b15-14+/t20-,21?/m0/s1 |
| InChIKey | WAYICGNUGRYAEH-LNDPSUFISA-N |
| XLogP | 6.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|