C36H55IO4Si2 — CID 139619866
tert-butyl-[1-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-iodo-5-(oxan-2-yloxy)pent-3-enoxy]-diphenylsilane (PubChem CID 139619866) has the molecular formula C36H55IO4Si2 and a molecular weight of 734.91 g/mol. Its IUPAC name is tert-butyl-[1-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-iodo-5-(oxan-2-yloxy)pent-3-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[1-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-iodo-5-(oxan-2-yloxy)pent-3-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 139619866 |
| Molecular Formula | C36H55IO4Si2 |
| Molecular Weight | 734.91 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | tert-butyl-[1-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-iodo-5-(oxan-2-yloxy)pent-3-enoxy]-diphenylsilane |
| SMILES | C=CC(CC(CC(I)=CCOC1CCCCO1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H55IO4Si2/c1-10-30(40-42(8,9)35(2,3)4)28-31(27-29(37)24-26-39-34-23-17-18-25-38-34)41-43(36(5,6)7,32-19-13-11-14-20-32)33-21-15-12-16-22-33/h10-16,19-22,24,30-31,34H,1,17-18,23,25-28H2,2-9H3 |
| InChIKey | ZLLMOXJEAYHAAX-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.91 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|